About Di-tert-butylphosphinoferrocene,95%
Di-tert-butylphosphinoferrocene,95% (PubChem CID 91654682) has the molecular formula C18H27FeP
and a molecular weight of 330.23 g/mol.
Molecular Properties
| Compound Name | Di-tert-butylphosphinoferrocene,95% |
| PubChem CID | 91654682 |
| Molecular Formula | C18H27FeP |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | — |
| SMILES | CC(C)(C)P(C1=CC=C[CH]1)C(C)(C)C.[CH]1C=CC=C1.[Fe] |
| InChI | InChI=1S/C13H22P.C5H5.Fe/c1-12(2,3)14(13(4,5)6)11-9-7-8-10-11;1-2-4-5-3-1;/h7-10H,1-6H3;1-5H; |
| InChIKey | KMOMYOJYWXJKCJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze Di-tert-butylphosphinoferrocene,95% with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Di-tert-butylphosphinoferrocene,95%?
The IUPAC name of Di-tert-butylphosphinoferrocene,95% (CID 91654682) is not available.
What is the SMILES notation for Di-tert-butylphosphinoferrocene,95%?
The canonical SMILES for Di-tert-butylphosphinoferrocene,95% is CC(C)(C)P(C1=CC=C[CH]1)C(C)(C)C.[CH]1C=CC=C1.[Fe].
What is the InChIKey of Di-tert-butylphosphinoferrocene,95%?
The InChIKey is KMOMYOJYWXJKCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22P.C5H5.Fe/c1-12(2,3)14(13(4,5)6)11-9-7-8-10-11;1-2-4-5-3-1;/h7-10H,1-6H3;1-5H;.
What are the key properties of Di-tert-butylphosphinoferrocene,95%?
Di-tert-butylphosphinoferrocene,95% has a molecular weight of 330.23 g/mol, XLogP of 6.04, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Di-tert-butylphosphinoferrocene,95% is sourced from PubChem (CID 91654682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).