C14H22O — CID 91656197
2-[4-(2-methylpropyl)phenyl]butan-2-ol (PubChem CID 91656197) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-[4-(2-methylpropyl)phenyl]butan-2-ol.
| Compound Name | 2-[4-(2-methylpropyl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 91656197 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2-[4-(2-methylpropyl)phenyl]butan-2-ol |
| SMILES | CCC(C)(O)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C14H22O/c1-5-14(4,15)13-8-6-12(7-9-13)10-11(2)3/h6-9,11,15H,5,10H2,1-4H3 |
| InChIKey | GJJSBOQUFXQVSW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |