C13H9BrF2MgO — CID 91656518
magnesium;2,4-difluoro-1-(phenylmethoxy)benzene;bromide (PubChem CID 91656518) has the molecular formula C13H9BrF2MgO and a molecular weight of 323.42 g/mol. Its IUPAC name is magnesium;2,4-difluoro-1-(phenylmethoxy)benzene;bromide.
| Compound Name | magnesium;2,4-difluoro-1-(phenylmethoxy)benzene;bromide |
|---|---|
| PubChem CID | 91656518 |
| Molecular Formula | C13H9BrF2MgO |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | magnesium;2,4-difluoro-1-(phenylmethoxy)benzene;bromide |
| SMILES | Fc1ccc(OCc2cc[c-]cc2)c(F)c1.[Br-].[Mg+2] |
| InChI | InChI=1S/C13H9F2O.BrH.Mg/c14-11-6-7-13(12(15)8-11)16-9-10-4-2-1-3-5-10;;/h2-8H,9H2;1H;/q-1;;+2/p-1 |
| InChIKey | KGMMJCJLBKQVQL-UHFFFAOYSA-M |
| XLogP | -0.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|