C13H15NO4 — CID 91656529
4-[2-(1,3-dioxolan-2-yl)ethoxy]-3-methoxybenzonitrile (PubChem CID 91656529) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-[2-(1,3-dioxolan-2-yl)ethoxy]-3-methoxybenzonitrile.
| Compound Name | 4-[2-(1,3-dioxolan-2-yl)ethoxy]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 91656529 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-[2-(1,3-dioxolan-2-yl)ethoxy]-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1OCCC1OCCO1 |
| InChI | InChI=1S/C13H15NO4/c1-15-12-8-10(9-14)2-3-11(12)16-5-4-13-17-6-7-18-13/h2-3,8,13H,4-7H2,1H3 |
| InChIKey | IBQKNAWZABNEMM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |