About S-(3,5-dimethylphenyl) ethanethioate
S-(3,5-dimethylphenyl) ethanethioate (PubChem CID 91656833) has the molecular formula C10H12OS
and a molecular weight of 180.27 g/mol. Its IUPAC name is S-(3,5-dimethylphenyl) ethanethioate.
Molecular Properties
| Compound Name | S-(3,5-dimethylphenyl) ethanethioate |
| PubChem CID | 91656833 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | S-(3,5-dimethylphenyl) ethanethioate |
| SMILES | CC(=O)Sc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C10H12OS/c1-7-4-8(2)6-10(5-7)12-9(3)11/h4-6H,1-3H3 |
| InChIKey | AEYWKWUCVYDERD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3,5-dimethylphenyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3,5-dimethylphenyl) ethanethioate?
The IUPAC name of S-(3,5-dimethylphenyl) ethanethioate (CID 91656833) is S-(3,5-dimethylphenyl) ethanethioate.
What is the SMILES notation for S-(3,5-dimethylphenyl) ethanethioate?
The canonical SMILES for S-(3,5-dimethylphenyl) ethanethioate is CC(=O)Sc1cc(C)cc(C)c1.
What is the InChIKey of S-(3,5-dimethylphenyl) ethanethioate?
The InChIKey is AEYWKWUCVYDERD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS/c1-7-4-8(2)6-10(5-7)12-9(3)11/h4-6H,1-3H3.
What are the key properties of S-(3,5-dimethylphenyl) ethanethioate?
S-(3,5-dimethylphenyl) ethanethioate has a molecular weight of 180.27 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3,5-dimethylphenyl) ethanethioate is sourced from PubChem (CID 91656833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).