About 2-Ethoxypyridin-5-ylmagnesium bromide, 0.25M in 2-MeTHF
2-Ethoxypyridin-5-ylmagnesium bromide, 0.25M in 2-MeTHF (PubChem CID 91657968) has the molecular formula C7H8BrMgNO
and a molecular weight of 226.35 g/mol. Its IUPAC name is magnesium;6-ethoxy-3H-pyridin-3-ide;bromide.
Molecular Properties
| Compound Name | 2-Ethoxypyridin-5-ylmagnesium bromide, 0.25M in 2-MeTHF |
| PubChem CID | 91657968 |
| Molecular Formula | C7H8BrMgNO |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 224.96 |
| IUPAC Name | magnesium;6-ethoxy-3H-pyridin-3-ide;bromide |
| SMILES | CCOC1=NC=[C-]C=C1.[Mg+2].[Br-] |
| InChI | InChI=1S/C7H8NO.BrH.Mg/c1-2-9-7-5-3-4-6-8-7;;/h3,5-6H,2H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | NYWDSMJBEZRJKT-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 21.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | 177 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-Ethoxypyridin-5-ylmagnesium bromide, 0.25M in 2-MeTHF with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Ethoxypyridin-5-ylmagnesium bromide, 0.25M in 2-MeTHF?
The IUPAC name of 2-Ethoxypyridin-5-ylmagnesium bromide, 0.25M in 2-MeTHF (CID 91657968) is magnesium;6-ethoxy-3H-pyridin-3-ide;bromide.
What is the SMILES notation for 2-Ethoxypyridin-5-ylmagnesium bromide, 0.25M in 2-MeTHF?
The canonical SMILES for 2-Ethoxypyridin-5-ylmagnesium bromide, 0.25M in 2-MeTHF is CCOC1=NC=[C-]C=C1.[Mg+2].[Br-].
What is the InChIKey of 2-Ethoxypyridin-5-ylmagnesium bromide, 0.25M in 2-MeTHF?
The InChIKey is NYWDSMJBEZRJKT-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8NO.BrH.Mg/c1-2-9-7-5-3-4-6-8-7;;/h3,5-6H,2H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of 2-Ethoxypyridin-5-ylmagnesium bromide, 0.25M in 2-MeTHF?
2-Ethoxypyridin-5-ylmagnesium bromide, 0.25M in 2-MeTHF has a molecular weight of 226.35 g/mol, XLogP of not available, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Ethoxypyridin-5-ylmagnesium bromide, 0.25M in 2-MeTHF is sourced from PubChem (CID 91657968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).