About bis(2-aminophenol);sulfuric acid
bis(2-aminophenol);sulfuric acid (PubChem CID 91658960) has the molecular formula C12H16N2O6S
and a molecular weight of 316.33 g/mol. Its IUPAC name is bis(2-aminophenol);sulfuric acid.
Molecular Properties
| Compound Name | bis(2-aminophenol);sulfuric acid |
| PubChem CID | 91658960 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | bis(2-aminophenol);sulfuric acid |
| SMILES | Nc1ccccc1O.Nc1ccccc1O.O=S(=O)(O)O |
| InChI | InChI=1S/2C6H7NO.H2O4S/c2*7-5-3-1-2-4-6(5)8;1-5(2,3)4/h2*1-4,8H,7H2;(H2,1,2,3,4) |
| InChIKey | SHUIDGXTJAQFJO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-aminophenol);sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-aminophenol);sulfuric acid?
The IUPAC name of bis(2-aminophenol);sulfuric acid (CID 91658960) is bis(2-aminophenol);sulfuric acid.
What is the SMILES notation for bis(2-aminophenol);sulfuric acid?
The canonical SMILES for bis(2-aminophenol);sulfuric acid is Nc1ccccc1O.Nc1ccccc1O.O=S(=O)(O)O.
What is the InChIKey of bis(2-aminophenol);sulfuric acid?
The InChIKey is SHUIDGXTJAQFJO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7NO.H2O4S/c2*7-5-3-1-2-4-6(5)8;1-5(2,3)4/h2*1-4,8H,7H2;(H2,1,2,3,4).
What are the key properties of bis(2-aminophenol);sulfuric acid?
bis(2-aminophenol);sulfuric acid has a molecular weight of 316.33 g/mol, XLogP of 1.30, 0 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-aminophenol);sulfuric acid is sourced from PubChem (CID 91658960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).