About Aminoferrocene, for HPLC derivatization, >=98.0% (T)
Aminoferrocene, for HPLC derivatization, >=98.0% (T) (PubChem CID 91659113) has the molecular formula C10H11FeN
and a molecular weight of 201.05 g/mol.
Molecular Properties
| Compound Name | Aminoferrocene, for HPLC derivatization, >=98.0% (T) |
| PubChem CID | 91659113 |
| Molecular Formula | C10H11FeN |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | — |
| SMILES | NC1=CC=C[CH]1.[CH]1C=CC=C1.[Fe] |
| InChI | InChI=1S/C5H6N.C5H5.Fe/c6-5-3-1-2-4-5;1-2-4-5-3-1;/h1-4H,6H2;1-5H; |
| InChIKey | JETZZOFQXXBFDQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Aminoferrocene, for HPLC derivatization, >=98.0% (T) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Aminoferrocene, for HPLC derivatization, >=98.0% (T)?
The IUPAC name of Aminoferrocene, for HPLC derivatization, >=98.0% (T) (CID 91659113) is not available.
What is the SMILES notation for Aminoferrocene, for HPLC derivatization, >=98.0% (T)?
The canonical SMILES for Aminoferrocene, for HPLC derivatization, >=98.0% (T) is NC1=CC=C[CH]1.[CH]1C=CC=C1.[Fe].
What is the InChIKey of Aminoferrocene, for HPLC derivatization, >=98.0% (T)?
The InChIKey is JETZZOFQXXBFDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N.C5H5.Fe/c6-5-3-1-2-4-5;1-2-4-5-3-1;/h1-4H,6H2;1-5H;.
What are the key properties of Aminoferrocene, for HPLC derivatization, >=98.0% (T)?
Aminoferrocene, for HPLC derivatization, >=98.0% (T) has a molecular weight of 201.05 g/mol, XLogP of 1.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Aminoferrocene, for HPLC derivatization, >=98.0% (T) is sourced from PubChem (CID 91659113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).