C27H25NO5S — CID 91659125
(1S,2R,7S,9R)-5-benzyl-12-phenyl-7-phenylsulfanyl-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-4-one (PubChem CID 91659125) has the molecular formula C27H25NO5S and a molecular weight of 475.57 g/mol. Its IUPAC name is (1S,2R,7S,9R)-5-benzyl-12-phenyl-7-phenylsulfanyl-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-4-one.
| Compound Name | (1S,2R,7S,9R)-5-benzyl-12-phenyl-7-phenylsulfanyl-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-4-one |
|---|---|
| PubChem CID | 91659125 |
| Molecular Formula | C27H25NO5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (1S,2R,7S,9R)-5-benzyl-12-phenyl-7-phenylsulfanyl-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-4-one |
| SMILES | O=C1O[C@@H]2C([C@H](Sc3ccccc3)O[C@@H]3COC(c4ccccc4)O[C@@H]23)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H25NO5S/c29-27-28(16-18-10-4-1-5-11-18)22-24(33-27)23-21(31-26(22)34-20-14-8-3-9-15-20)17-30-25(32-23)19-12-6-2-7-13-19/h1-15,21-26H,16-17H2/t21-,22?,23-,24-,25?,26+/m1/s1 |
| InChIKey | IPBJFGDRNYVDGL-TWGFCZDUSA-N |
| XLogP | 5.01 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |