About 2,6-dibromothieno[3,2-f][1]benzothiole
2,6-dibromothieno[3,2-f][1]benzothiole (PubChem CID 91659146) has the molecular formula C10H4Br2S2
and a molecular weight of 348.08 g/mol. Its IUPAC name is 2,6-dibromothieno[3,2-f][1]benzothiole.
Molecular Properties
| Compound Name | 2,6-dibromothieno[3,2-f][1]benzothiole |
| PubChem CID | 91659146 |
| Molecular Formula | C10H4Br2S2 |
| Molecular Weight | 348.08 g/mol |
| Exact Mass | 345.81 |
| IUPAC Name | 2,6-dibromothieno[3,2-f][1]benzothiole |
| SMILES | Brc1cc2cc3cc(Br)sc3cc2s1 |
| InChI | InChI=1S/C10H4Br2S2/c11-9-2-5-1-6-3-10(12)14-8(6)4-7(5)13-9/h1-4H |
| InChIKey | PZJRHIYHVCHULC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.08 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dibromothieno[3,2-f][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromothieno[3,2-f][1]benzothiole?
The IUPAC name of 2,6-dibromothieno[3,2-f][1]benzothiole (CID 91659146) is 2,6-dibromothieno[3,2-f][1]benzothiole.
What is the SMILES notation for 2,6-dibromothieno[3,2-f][1]benzothiole?
The canonical SMILES for 2,6-dibromothieno[3,2-f][1]benzothiole is Brc1cc2cc3cc(Br)sc3cc2s1.
What is the InChIKey of 2,6-dibromothieno[3,2-f][1]benzothiole?
The InChIKey is PZJRHIYHVCHULC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4Br2S2/c11-9-2-5-1-6-3-10(12)14-8(6)4-7(5)13-9/h1-4H.
What are the key properties of 2,6-dibromothieno[3,2-f][1]benzothiole?
2,6-dibromothieno[3,2-f][1]benzothiole has a molecular weight of 348.08 g/mol, XLogP of 5.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromothieno[3,2-f][1]benzothiole is sourced from PubChem (CID 91659146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).