C17H29N5O2 — CID 91660049
tert-butyl 3-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]piperidine-1-carboxylate (PubChem CID 91660049) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl 3-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91660049 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | tert-butyl 3-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]piperidine-1-carboxylate |
| SMILES | Cc1nc2n(n1)CC(NC1CCCN(C(=O)OC(C)(C)C)C1)CC2 |
| InChI | InChI=1S/C17H29N5O2/c1-12-18-15-8-7-14(11-22(15)20-12)19-13-6-5-9-21(10-13)16(23)24-17(2,3)4/h13-14,19H,5-11H2,1-4H3 |
| InChIKey | YBEQLLDJXKEKPM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |