About 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide
2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide (PubChem CID 91660071) has the molecular formula C12H19N3O2S
and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide |
| PubChem CID | 91660071 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide |
| SMILES | CO[C@H]1CNCC1NC(=O)Cc1nc(C)sc1C |
| InChI | InChI=1S/C12H19N3O2S/c1-7-9(14-8(2)18-7)4-12(16)15-10-5-13-6-11(10)17-3/h10-11,13H,4-6H2,1-3H3,(H,15,16)/t10?,11-/m0/s1 |
| InChIKey | DVGDUIBNRSWTRP-DTIOYNMSSA-N |
| XLogP | 0.41 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide?
The IUPAC name of 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide (CID 91660071) is 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide.
What is the SMILES notation for 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide?
The canonical SMILES for 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide is CO[C@H]1CNCC1NC(=O)Cc1nc(C)sc1C.
What is the InChIKey of 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide?
The InChIKey is DVGDUIBNRSWTRP-DTIOYNMSSA-N. The full InChI is InChI=1S/C12H19N3O2S/c1-7-9(14-8(2)18-7)4-12(16)15-10-5-13-6-11(10)17-3/h10-11,13H,4-6H2,1-3H3,(H,15,16)/t10?,11-/m0/s1.
What are the key properties of 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide?
2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide has a molecular weight of 269.37 g/mol, XLogP of 0.41, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(4S)-4-methoxypyrrolidin-3-yl]acetamide is sourced from PubChem (CID 91660071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).