About 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol
1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol (PubChem CID 91660440) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol.
Molecular Properties
| Compound Name | 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol |
| PubChem CID | 91660440 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol |
| SMILES | CCC(O)CNC(CC)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C13H25N3O/c1-6-11(17)8-14-12(7-2)13-9(3)15-16(5)10(13)4/h11-12,14,17H,6-8H2,1-5H3 |
| InChIKey | CXEJJYGMPCNZAE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol?
The IUPAC name of 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol (CID 91660440) is 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol.
What is the SMILES notation for 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol?
The canonical SMILES for 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol is CCC(O)CNC(CC)c1c(C)nn(C)c1C.
What is the InChIKey of 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol?
The InChIKey is CXEJJYGMPCNZAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O/c1-6-11(17)8-14-12(7-2)13-9(3)15-16(5)10(13)4/h11-12,14,17H,6-8H2,1-5H3.
What are the key properties of 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol?
1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol has a molecular weight of 239.36 g/mol, XLogP of 1.85, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1,3,5-trimethylpyrazol-4-yl)propylamino]butan-2-ol is sourced from PubChem (CID 91660440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).