About 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one
3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 91660494) has the molecular formula C9H10N2O2S
and a molecular weight of 210.26 g/mol. Its IUPAC name is 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 91660494 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCOCn1cnc2sccc2c1=O |
| InChI | InChI=1S/C9H10N2O2S/c1-2-13-6-11-5-10-8-7(9(11)12)3-4-14-8/h3-5H,2,6H2,1H3 |
| InChIKey | BAVQCFCTDNEELQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one (CID 91660494) is 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one is CCOCn1cnc2sccc2c1=O.
What is the InChIKey of 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one?
The InChIKey is BAVQCFCTDNEELQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2S/c1-2-13-6-11-5-10-8-7(9(11)12)3-4-14-8/h3-5H,2,6H2,1H3.
What are the key properties of 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one?
3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one has a molecular weight of 210.26 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethoxymethyl)thieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 91660494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).