About N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide
N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide (PubChem CID 91660910) has the molecular formula C13H15BrN4O
and a molecular weight of 323.19 g/mol. Its IUPAC name is N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide |
| PubChem CID | 91660910 |
| Molecular Formula | C13H15BrN4O |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide |
| SMILES | CC(=O)NCCCNc1ccnc2cc(Br)cnc12 |
| InChI | InChI=1S/C13H15BrN4O/c1-9(19)15-4-2-5-16-11-3-6-17-12-7-10(14)8-18-13(11)12/h3,6-8H,2,4-5H2,1H3,(H,15,19)(H,16,17) |
| InChIKey | JRLHNTLYEYTOBM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide?
The IUPAC name of N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide (CID 91660910) is N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide.
What is the SMILES notation for N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide?
The canonical SMILES for N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide is CC(=O)NCCCNc1ccnc2cc(Br)cnc12.
What is the InChIKey of N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide?
The InChIKey is JRLHNTLYEYTOBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrN4O/c1-9(19)15-4-2-5-16-11-3-6-17-12-7-10(14)8-18-13(11)12/h3,6-8H,2,4-5H2,1H3,(H,15,19)(H,16,17).
What are the key properties of N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide?
N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide has a molecular weight of 323.19 g/mol, XLogP of 2.33, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(7-bromo-1,5-naphthyridin-4-yl)amino]propyl]acetamide is sourced from PubChem (CID 91660910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).