About 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole
1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole (PubChem CID 91661120) has the molecular formula C11H10F3N3O
and a molecular weight of 257.21 g/mol. Its IUPAC name is 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole.
Molecular Properties
| Compound Name | 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole |
| PubChem CID | 91661120 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole |
| SMILES | FC(F)(F)COc1ccccc1Cn1ccnn1 |
| InChI | InChI=1S/C11H10F3N3O/c12-11(13,14)8-18-10-4-2-1-3-9(10)7-17-6-5-15-16-17/h1-6H,7-8H2 |
| InChIKey | TZPXLKOPGOZIOG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole?
The IUPAC name of 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole (CID 91661120) is 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole.
What is the SMILES notation for 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole?
The canonical SMILES for 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole is FC(F)(F)COc1ccccc1Cn1ccnn1.
What is the InChIKey of 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole?
The InChIKey is TZPXLKOPGOZIOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3N3O/c12-11(13,14)8-18-10-4-2-1-3-9(10)7-17-6-5-15-16-17/h1-6H,7-8H2.
What are the key properties of 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole?
1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole has a molecular weight of 257.21 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]triazole is sourced from PubChem (CID 91661120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).