C19H21BrN2O3 — CID 9166143
4-[(2S)-3-[2-(4-bromophenoxy)ethyl-methylamino]-2-hydroxypropoxy]benzonitrile (PubChem CID 9166143) has the molecular formula C19H21BrN2O3 and a molecular weight of 405.29 g/mol. Its IUPAC name is 4-[(2S)-3-[2-(4-bromophenoxy)ethyl-methylamino]-2-hydroxypropoxy]benzonitrile.
| Compound Name | 4-[(2S)-3-[2-(4-bromophenoxy)ethyl-methylamino]-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 9166143 |
| Molecular Formula | C19H21BrN2O3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 4-[(2S)-3-[2-(4-bromophenoxy)ethyl-methylamino]-2-hydroxypropoxy]benzonitrile |
| SMILES | CN(CCOc1ccc(Br)cc1)C[C@H](O)COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H21BrN2O3/c1-22(10-11-24-18-8-4-16(20)5-9-18)13-17(23)14-25-19-6-2-15(12-21)3-7-19/h2-9,17,23H,10-11,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | YTPFRDGVDWSSNF-KRWDZBQOSA-N |
| XLogP | 3.07 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |