About (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate
(2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate (PubChem CID 91662310) has the molecular formula C19H19N3O3
and a molecular weight of 337.38 g/mol. Its IUPAC name is (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate |
| PubChem CID | 91662310 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate |
| SMILES | Cn1cnc2cc(C(=O)OCC3CCOC3c3ccccc3)cnc21 |
| InChI | InChI=1S/C19H19N3O3/c1-22-12-21-16-9-15(10-20-18(16)22)19(23)25-11-14-7-8-24-17(14)13-5-3-2-4-6-13/h2-6,9-10,12,14,17H,7-8,11H2,1H3 |
| InChIKey | JOYMVOISDNPULF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
The IUPAC name of (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate (CID 91662310) is (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate.
What is the SMILES notation for (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
The canonical SMILES for (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate is Cn1cnc2cc(C(=O)OCC3CCOC3c3ccccc3)cnc21.
What is the InChIKey of (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
The InChIKey is JOYMVOISDNPULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O3/c1-22-12-21-16-9-15(10-20-18(16)22)19(23)25-11-14-7-8-24-17(14)13-5-3-2-4-6-13/h2-6,9-10,12,14,17H,7-8,11H2,1H3.
What are the key properties of (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
(2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate has a molecular weight of 337.38 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyloxolan-3-yl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate is sourced from PubChem (CID 91662310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).