About 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride
1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride (PubChem CID 91663079) has the molecular formula C8H13ClF3NO2
and a molecular weight of 247.64 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride |
| PubChem CID | 91663079 |
| Molecular Formula | C8H13ClF3NO2 |
| Molecular Weight | 247.64 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C8H12F3NO2.ClH/c9-8(10,11)5-12-3-1-6(2-4-12)7(13)14;/h6H,1-5H2,(H,13,14);1H |
| InChIKey | HILXVLFKNDOPHA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.64 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride?
The IUPAC name of 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride (CID 91663079) is 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride.
What is the SMILES notation for 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride?
The canonical SMILES for 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride is Cl.O=C(O)C1CCN(CC(F)(F)F)CC1.
What is the InChIKey of 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride?
The InChIKey is HILXVLFKNDOPHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO2.ClH/c9-8(10,11)5-12-3-1-6(2-4-12)7(13)14;/h6H,1-5H2,(H,13,14);1H.
What are the key properties of 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride?
1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride has a molecular weight of 247.64 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethyl)piperidine-4-carboxylic acid;hydrochloride is sourced from PubChem (CID 91663079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).