C17H21N7OS — CID 9166316
1-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethanone (PubChem CID 9166316) has the molecular formula C17H21N7OS and a molecular weight of 371.47 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethanone.
| Compound Name | 1-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 9166316 |
| Molecular Formula | C17H21N7OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethanone |
| SMILES | Cc1cc(C(=O)CSc2nnc3n2CCCCC3)c(C)n1-c1ncn[nH]1 |
| InChI | InChI=1S/C17H21N7OS/c1-11-8-13(12(2)24(11)16-18-10-19-21-16)14(25)9-26-17-22-20-15-6-4-3-5-7-23(15)17/h8,10H,3-7,9H2,1-2H3,(H,18,19,21) |
| InChIKey | ZZEURLCBMPSABJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |