About 2-methyl-1,2-dihydropyrazin-3-amine
2-methyl-1,2-dihydropyrazin-3-amine (PubChem CID 91663216) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 2-methyl-1,2-dihydropyrazin-3-amine.
Molecular Properties
| Compound Name | 2-methyl-1,2-dihydropyrazin-3-amine |
| PubChem CID | 91663216 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 2-methyl-1,2-dihydropyrazin-3-amine |
| SMILES | CC1NC=CN=C1N |
| InChI | InChI=1S/C5H9N3/c1-4-5(6)8-3-2-7-4/h2-4,7H,1H3,(H2,6,8) |
| InChIKey | YQKSJCHJTNVEJQ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1,2-dihydropyrazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,2-dihydropyrazin-3-amine?
The IUPAC name of 2-methyl-1,2-dihydropyrazin-3-amine (CID 91663216) is 2-methyl-1,2-dihydropyrazin-3-amine.
What is the SMILES notation for 2-methyl-1,2-dihydropyrazin-3-amine?
The canonical SMILES for 2-methyl-1,2-dihydropyrazin-3-amine is CC1NC=CN=C1N.
What is the InChIKey of 2-methyl-1,2-dihydropyrazin-3-amine?
The InChIKey is YQKSJCHJTNVEJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c1-4-5(6)8-3-2-7-4/h2-4,7H,1H3,(H2,6,8).
What are the key properties of 2-methyl-1,2-dihydropyrazin-3-amine?
2-methyl-1,2-dihydropyrazin-3-amine has a molecular weight of 111.15 g/mol, XLogP of -0.19, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,2-dihydropyrazin-3-amine is sourced from PubChem (CID 91663216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).