C26H22F7N3O4S — CID 91663305
2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 91663305) has the molecular formula C26H22F7N3O4S and a molecular weight of 605.53 g/mol. Its IUPAC name is 2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 91663305 |
| Molecular Formula | C26H22F7N3O4S |
| Molecular Weight | 605.53 g/mol |
| Exact Mass | 605.12 |
| IUPAC Name | 2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | O=C(C[C@@H]1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1)NCc1ccncc1 |
| InChI | InChI=1S/C26H22F7N3O4S/c27-19-3-6-21(7-4-19)41(39,40)36-20(14-23(37)35-15-16-9-11-34-12-10-16)5-1-17-13-18(2-8-22(17)36)24(38,25(28,29)30)26(31,32)33/h2-4,6-13,20,38H,1,5,14-15H2,(H,35,37)/t20-/m0/s1 |
| InChIKey | ZUOLMCXGDRMSAG-FQEVSTJZSA-N |
| XLogP | 4.75 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |