About N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride
N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride (PubChem CID 91663353) has the molecular formula C14H22Cl2N2
and a molecular weight of 289.25 g/mol. Its IUPAC name is N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride |
| PubChem CID | 91663353 |
| Molecular Formula | C14H22Cl2N2 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc([C@@H]2C[C@H]2NC2CCNCC2)cc1 |
| InChI | InChI=1S/C14H20N2.2ClH/c1-2-4-11(5-3-1)13-10-14(13)16-12-6-8-15-9-7-12;;/h1-5,12-16H,6-10H2;2*1H/t13-,14+;;/m0../s1 |
| InChIKey | PJFZOGMSPBHPNS-WICJZZOFSA-N |
| XLogP | 2.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride?
The IUPAC name of N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride (CID 91663353) is N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride.
What is the SMILES notation for N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride?
The canonical SMILES for N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride is Cl.Cl.c1ccc([C@@H]2C[C@H]2NC2CCNCC2)cc1.
What is the InChIKey of N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride?
The InChIKey is PJFZOGMSPBHPNS-WICJZZOFSA-N. The full InChI is InChI=1S/C14H20N2.2ClH/c1-2-4-11(5-3-1)13-10-14(13)16-12-6-8-15-9-7-12;;/h1-5,12-16H,6-10H2;2*1H/t13-,14+;;/m0../s1.
What are the key properties of N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride?
N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride has a molecular weight of 289.25 g/mol, XLogP of 2.73, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride is sourced from PubChem (CID 91663353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).