C21H21F2N3O6S — CID 91663384
4-[4-[[3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 91663384) has the molecular formula C21H21F2N3O6S and a molecular weight of 481.48 g/mol. Its IUPAC name is 4-[4-[[3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[4-[[3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 91663384 |
| Molecular Formula | C21H21F2N3O6S |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 4-[4-[[3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCc1ccc(OCc2nc(-c3c(F)cccc3F)no2)cc1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C21H21F2N3O6S/c1-21(20(27)25-28,33(2,29)30)11-10-13-6-8-14(9-7-13)31-12-17-24-19(26-32-17)18-15(22)4-3-5-16(18)23/h3-9,28H,10-12H2,1-2H3,(H,25,27) |
| InChIKey | NXUHPMODLVTUMH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|