C21H21N3O2 — CID 91663472
[(4aS)-7-hydroxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-benzimidazol-5-yl)methanone (PubChem CID 91663472) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is [(4aS)-7-hydroxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-benzimidazol-5-yl)methanone.
| Compound Name | [(4aS)-7-hydroxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 91663472 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [(4aS)-7-hydroxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-benzimidazol-5-yl)methanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCCC2c3cccc(O)c3CC[C@@H]21 |
| InChI | InChI=1S/C21H21N3O2/c25-20-5-1-3-14-15-4-2-10-24(19(15)9-7-16(14)20)21(26)13-6-8-17-18(11-13)23-12-22-17/h1,3,5-6,8,11-12,15,19,25H,2,4,7,9-10H2,(H,22,23)/t15?,19-/m0/s1 |
| InChIKey | YSGRGDDXHXDDQL-FUBQLUNQSA-N |
| XLogP | 3.60 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |