C22H23N3O2 — CID 91663473
[(4aS)-10-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-benzimidazol-5-yl)methanone (PubChem CID 91663473) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is [(4aS)-10-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-benzimidazol-5-yl)methanone.
| Compound Name | [(4aS)-10-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 91663473 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | [(4aS)-10-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-benzimidazol-5-yl)methanone |
| SMILES | COc1cccc2c1C1CCCN(C(=O)c3ccc4nc[nH]c4c3)[C@H]1CC2 |
| InChI | InChI=1S/C22H23N3O2/c1-27-20-6-2-4-14-8-10-19-16(21(14)20)5-3-11-25(19)22(26)15-7-9-17-18(12-15)24-13-23-17/h2,4,6-7,9,12-13,16,19H,3,5,8,10-11H2,1H3,(H,23,24)/t16?,19-/m0/s1 |
| InChIKey | OSEMOEIRGCDFLV-CVMIBEPCSA-N |
| XLogP | 3.91 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |