C29H29N3O2 — CID 91663505
[(4aS)-10-[(4-methoxyphenyl)methyl]-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-benzimidazol-5-yl)methanone (PubChem CID 91663505) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is [(4aS)-10-[(4-methoxyphenyl)methyl]-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-benzimidazol-5-yl)methanone.
| Compound Name | [(4aS)-10-[(4-methoxyphenyl)methyl]-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 91663505 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | [(4aS)-10-[(4-methoxyphenyl)methyl]-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3H-benzimidazol-5-yl)methanone |
| SMILES | COc1ccc(Cc2cccc3c2C2CCCN(C(=O)c4ccc5nc[nH]c5c4)[C@H]2CC3)cc1 |
| InChI | InChI=1S/C29H29N3O2/c1-34-23-11-7-19(8-12-23)16-21-5-2-4-20-10-14-27-24(28(20)21)6-3-15-32(27)29(33)22-9-13-25-26(17-22)31-18-30-25/h2,4-5,7-9,11-13,17-18,24,27H,3,6,10,14-16H2,1H3,(H,30,31)/t24?,27-/m0/s1 |
| InChIKey | VFUOTBTUJHQZEI-WKDCXCOVSA-N |
| XLogP | 5.50 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |