bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid

C26H46N4O8 — CID 91663913

IUPACbis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid
SMILESCC(C)(C)OC(=O)N1CCC2(CCN2)CC1.CC(C)(C)OC(=O)N1CCC2(CCN2)CC1.O=C(O)C(=O)O
InChIInChI=1S/2C12H22N2O2.C2H2O4/c2*1-11(2,3)16-10(15)14-8-5-12(6-9-14)4-7-13-12;3-1(4)2(5)6/h2*13H,4-9H2,1-3H3;(H,3,4)(H,5,6)
InChIKeyXQRSXALCTKGWGZ-UHFFFAOYSA-N
MW542.67 g/mol
LogP2.65
Rot. Bonds

About bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid

bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid (PubChem CID 91663913) has the molecular formula C26H46N4O8 and a molecular weight of 542.67 g/mol. Its IUPAC name is bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid.

Molecular Properties

Compound Namebis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid
PubChem CID91663913
Molecular FormulaC26H46N4O8
Molecular Weight542.67 g/mol
Exact Mass542.33
IUPAC Namebis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid
SMILESCC(C)(C)OC(=O)N1CCC2(CCN2)CC1.CC(C)(C)OC(=O)N1CCC2(CCN2)CC1.O=C(O)C(=O)O
InChIInChI=1S/2C12H22N2O2.C2H2O4/c2*1-11(2,3)16-10(15)14-8-5-12(6-9-14)4-7-13-12;3-1(4)2(5)6/h2*13H,4-9H2,1-3H3;(H,3,4)(H,5,6)
InChIKeyXQRSXALCTKGWGZ-UHFFFAOYSA-N
XLogP2.65
TPSA157.74 Ų
H-Bond Donors4
H-Bond Acceptors8
Rotatable Bonds
Heavy Atoms38
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500542.67
LogP ≤ 52.65
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid?
The IUPAC name of bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid (CID 91663913) is bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid.
What is the SMILES notation for bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid?
The canonical SMILES for bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid is CC(C)(C)OC(=O)N1CCC2(CCN2)CC1.CC(C)(C)OC(=O)N1CCC2(CCN2)CC1.O=C(O)C(=O)O.
What is the InChIKey of bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid?
The InChIKey is XQRSXALCTKGWGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H22N2O2.C2H2O4/c2*1-11(2,3)16-10(15)14-8-5-12(6-9-14)4-7-13-12;3-1(4)2(5)6/h2*13H,4-9H2,1-3H3;(H,3,4)(H,5,6).
What are the key properties of bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid?
bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid has a molecular weight of 542.67 g/mol, XLogP of 2.65, 0 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate);oxalic acid is sourced from PubChem (CID 91663913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).