About 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid
10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid (PubChem CID 91664021) has the molecular formula C16H9IN2O2
and a molecular weight of 388.16 g/mol. Its IUPAC name is 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid.
Molecular Properties
| Compound Name | 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid |
| PubChem CID | 91664021 |
| Molecular Formula | C16H9IN2O2 |
| Molecular Weight | 388.16 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid |
| SMILES | O=C(O)c1nc2ccccc2c2[nH]c3c(I)cccc3c12 |
| InChI | InChI=1S/C16H9IN2O2/c17-10-6-3-5-9-12-14(19-13(9)10)8-4-1-2-7-11(8)18-15(12)16(20)21/h1-7,19H,(H,20,21) |
| InChIKey | SDRAETFVRBBLOB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.16 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid?
The IUPAC name of 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid (CID 91664021) is 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid.
What is the SMILES notation for 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid?
The canonical SMILES for 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid is O=C(O)c1nc2ccccc2c2[nH]c3c(I)cccc3c12.
What is the InChIKey of 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid?
The InChIKey is SDRAETFVRBBLOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9IN2O2/c17-10-6-3-5-9-12-14(19-13(9)10)8-4-1-2-7-11(8)18-15(12)16(20)21/h1-7,19H,(H,20,21).
What are the key properties of 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid?
10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid has a molecular weight of 388.16 g/mol, XLogP of 4.17, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid is sourced from PubChem (CID 91664021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).