C13H8BrClN4S — CID 91664221
5-bromo-4-[2-(2-chlorophenyl)-1,3-thiazol-5-yl]pyrimidin-2-amine (PubChem CID 91664221) has the molecular formula C13H8BrClN4S and a molecular weight of 367.66 g/mol. Its IUPAC name is 5-bromo-4-[2-(2-chlorophenyl)-1,3-thiazol-5-yl]pyrimidin-2-amine.
| Compound Name | 5-bromo-4-[2-(2-chlorophenyl)-1,3-thiazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 91664221 |
| Molecular Formula | C13H8BrClN4S |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | 5-bromo-4-[2-(2-chlorophenyl)-1,3-thiazol-5-yl]pyrimidin-2-amine |
| SMILES | Nc1ncc(Br)c(-c2cnc(-c3ccccc3Cl)s2)n1 |
| InChI | InChI=1S/C13H8BrClN4S/c14-8-5-18-13(16)19-11(8)10-6-17-12(20-10)7-3-1-2-4-9(7)15/h1-6H,(H2,16,18,19) |
| InChIKey | GBSWZKTUMNXKKX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |