C64H76MnN8O4+5 — CID 91664357
manganese(3+);(20Z)-5,10,15-tris[1-(2-butoxyethyl)pyridin-1-ium-2-yl]-20-[1-(2-butoxyethyl)-2-pyridinylidene]porphyrin-22-ide (PubChem CID 91664357) has the molecular formula C64H76MnN8O4+5 and a molecular weight of 1076.30 g/mol. Its IUPAC name is manganese(3+);(20Z)-5,10,15-tris[1-(2-butoxyethyl)pyridin-1-ium-2-yl]-20-[1-(2-butoxyethyl)-2-pyridinylidene]porphyrin-22-ide.
| Compound Name | manganese(3+);(20Z)-5,10,15-tris[1-(2-butoxyethyl)pyridin-1-ium-2-yl]-20-[1-(2-butoxyethyl)-2-pyridinylidene]porphyrin-22-ide |
|---|---|
| PubChem CID | 91664357 |
| Molecular Formula | C64H76MnN8O4+5 |
| Molecular Weight | 1076.30 g/mol |
| Exact Mass | 1075.53 |
| IUPAC Name | manganese(3+);(20Z)-5,10,15-tris[1-(2-butoxyethyl)pyridin-1-ium-2-yl]-20-[1-(2-butoxyethyl)-2-pyridinylidene]porphyrin-22-ide |
| SMILES | CCCCOCCN1C=CC=C/C1=C1/C2=N/C(=C(/c3cccc[n+]3CCOCCCC)C3=N/C(=C(/c4cccc[n+]4CCOCCCC)c4ccc([n-]4)/C(c4cccc[n+]4CCOCCCC)=C4/C=CC1=N4)C=C3)C=C2.[Mn+3] |
| InChI | InChI=1S/C64H76N8O4.Mn/c1-5-9-41-73-45-37-69-33-17-13-21-57(69)61-49-25-27-51(65-49)62(58-22-14-18-34-70(58)38-46-74-42-10-6-2)53-29-31-55(67-53)64(60-24-16-20-36-72(60)40-48-76-44-12-8-4)56-32-30-54(68-56)63(52-28-26-50(61)66-52)59-23-15-19-35-71(59)39-47-75-43-11-7-3;/h13-36H,5-12,37-48H2,1-4H3;/q+2;+3 |
| InChIKey | CZXJDWRMJZZOTQ-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 102.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1076.30 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|