About 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one
5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one (PubChem CID 91664555) has the molecular formula C15H11N3O
and a molecular weight of 249.27 g/mol. Its IUPAC name is 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one |
| PubChem CID | 91664555 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2cc(-c3cc4cccnc4[nH]3)ccc21 |
| InChI | InChI=1S/C15H11N3O/c19-15-12-4-3-9(6-11(12)8-17-15)13-7-10-2-1-5-16-14(10)18-13/h1-7H,8H2,(H,16,18)(H,17,19) |
| InChIKey | UBPMSMINURQQNV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one?
The IUPAC name of 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one (CID 91664555) is 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one?
The canonical SMILES for 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one is O=C1NCc2cc(-c3cc4cccnc4[nH]3)ccc21.
What is the InChIKey of 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one?
The InChIKey is UBPMSMINURQQNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O/c19-15-12-4-3-9(6-11(12)8-17-15)13-7-10-2-1-5-16-14(10)18-13/h1-7H,8H2,(H,16,18)(H,17,19).
What are the key properties of 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one?
5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one has a molecular weight of 249.27 g/mol, XLogP of 2.47, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-pyrrolo[2,3-b]pyridin-2-yl)-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 91664555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).