About 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine
5-(furan-2-yl)-N,N-dimethylpyridin-2-amine (PubChem CID 91664813) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine |
| PubChem CID | 91664813 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1ccc(-c2ccco2)cn1 |
| InChI | InChI=1S/C11H12N2O/c1-13(2)11-6-5-9(8-12-11)10-4-3-7-14-10/h3-8H,1-2H3 |
| InChIKey | CNCCMUXWVUAGFG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine?
The IUPAC name of 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine (CID 91664813) is 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine.
What is the SMILES notation for 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine?
The canonical SMILES for 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine is CN(C)c1ccc(-c2ccco2)cn1.
What is the InChIKey of 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine?
The InChIKey is CNCCMUXWVUAGFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-13(2)11-6-5-9(8-12-11)10-4-3-7-14-10/h3-8H,1-2H3.
What are the key properties of 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine?
5-(furan-2-yl)-N,N-dimethylpyridin-2-amine has a molecular weight of 188.23 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-2-yl)-N,N-dimethylpyridin-2-amine is sourced from PubChem (CID 91664813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).