About 4-amino-2,3-dihydro-1H-indene-2-carboxylate
4-amino-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 91665602) has the molecular formula C10H10NO2-
and a molecular weight of 176.20 g/mol. Its IUPAC name is 4-amino-2,3-dihydro-1H-indene-2-carboxylate.
Molecular Properties
| Compound Name | 4-amino-2,3-dihydro-1H-indene-2-carboxylate |
| PubChem CID | 91665602 |
| Molecular Formula | C10H10NO2- |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 4-amino-2,3-dihydro-1H-indene-2-carboxylate |
| SMILES | Nc1cccc2c1CC(C(=O)[O-])C2 |
| InChI | InChI=1S/C10H11NO2/c11-9-3-1-2-6-4-7(10(12)13)5-8(6)9/h1-3,7H,4-5,11H2,(H,12,13)/p-1 |
| InChIKey | XATRQLHAJSSSDN-UHFFFAOYSA-M |
| XLogP | -0.27 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,3-dihydro-1H-indene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,3-dihydro-1H-indene-2-carboxylate?
The IUPAC name of 4-amino-2,3-dihydro-1H-indene-2-carboxylate (CID 91665602) is 4-amino-2,3-dihydro-1H-indene-2-carboxylate.
What is the SMILES notation for 4-amino-2,3-dihydro-1H-indene-2-carboxylate?
The canonical SMILES for 4-amino-2,3-dihydro-1H-indene-2-carboxylate is Nc1cccc2c1CC(C(=O)[O-])C2.
What is the InChIKey of 4-amino-2,3-dihydro-1H-indene-2-carboxylate?
The InChIKey is XATRQLHAJSSSDN-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H11NO2/c11-9-3-1-2-6-4-7(10(12)13)5-8(6)9/h1-3,7H,4-5,11H2,(H,12,13)/p-1.
What are the key properties of 4-amino-2,3-dihydro-1H-indene-2-carboxylate?
4-amino-2,3-dihydro-1H-indene-2-carboxylate has a molecular weight of 176.20 g/mol, XLogP of -0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,3-dihydro-1H-indene-2-carboxylate is sourced from PubChem (CID 91665602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).