C14H16N4O — CID 91665635
cis-(1R,3S)-3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexan-1-ol (PubChem CID 91665635) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is cis-(1R,3S)-3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexan-1-ol.
| Compound Name | cis-(1R,3S)-3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 91665635 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | cis-(1R,3S)-3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCC[C@H](n2cnc3cnc4[nH]ccc4c32)C1 |
| InChI | InChI=1S/C14H16N4O/c19-10-3-1-2-9(6-10)18-8-17-12-7-16-14-11(13(12)18)4-5-15-14/h4-5,7-10,19H,1-3,6H2,(H,15,16)/t9-,10+/m0/s1 |
| InChIKey | QMKAGLCRQDVJMP-VHSXEESVSA-N |
| XLogP | 2.39 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |