About 1H-quinoline-2,3,4-trione;hydrate
1H-quinoline-2,3,4-trione;hydrate (PubChem CID 91665944) has the molecular formula C9H7NO4
and a molecular weight of 193.16 g/mol. Its IUPAC name is 1H-quinoline-2,3,4-trione;hydrate.
Molecular Properties
| Compound Name | 1H-quinoline-2,3,4-trione;hydrate |
| PubChem CID | 91665944 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 1H-quinoline-2,3,4-trione;hydrate |
| SMILES | O.O=C1Nc2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C9H5NO3.H2O/c11-7-5-3-1-2-4-6(5)10-9(13)8(7)12;/h1-4H,(H,10,13);1H2 |
| InChIKey | LKGMGKHLJJTZJK-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-quinoline-2,3,4-trione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-quinoline-2,3,4-trione;hydrate?
The IUPAC name of 1H-quinoline-2,3,4-trione;hydrate (CID 91665944) is 1H-quinoline-2,3,4-trione;hydrate.
What is the SMILES notation for 1H-quinoline-2,3,4-trione;hydrate?
The canonical SMILES for 1H-quinoline-2,3,4-trione;hydrate is O.O=C1Nc2ccccc2C(=O)C1=O.
What is the InChIKey of 1H-quinoline-2,3,4-trione;hydrate?
The InChIKey is LKGMGKHLJJTZJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO3.H2O/c11-7-5-3-1-2-4-6(5)10-9(13)8(7)12;/h1-4H,(H,10,13);1H2.
What are the key properties of 1H-quinoline-2,3,4-trione;hydrate?
1H-quinoline-2,3,4-trione;hydrate has a molecular weight of 193.16 g/mol, XLogP of -0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-quinoline-2,3,4-trione;hydrate is sourced from PubChem (CID 91665944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).