About [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol
[1,3]oxazolo[4,5-b]pyridin-5-ylmethanol (PubChem CID 91666249) has the molecular formula C7H6N2O2
and a molecular weight of 150.14 g/mol. Its IUPAC name is [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol.
Molecular Properties
| Compound Name | [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol |
| PubChem CID | 91666249 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol |
| SMILES | OCc1ccc2ocnc2n1 |
| InChI | InChI=1S/C7H6N2O2/c10-3-5-1-2-6-7(9-5)8-4-11-6/h1-2,4,10H,3H2 |
| InChIKey | LPTOKCLJXCXWTD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol?
The IUPAC name of [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol (CID 91666249) is [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol.
What is the SMILES notation for [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol?
The canonical SMILES for [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol is OCc1ccc2ocnc2n1.
What is the InChIKey of [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol?
The InChIKey is LPTOKCLJXCXWTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c10-3-5-1-2-6-7(9-5)8-4-11-6/h1-2,4,10H,3H2.
What are the key properties of [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol?
[1,3]oxazolo[4,5-b]pyridin-5-ylmethanol has a molecular weight of 150.14 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]oxazolo[4,5-b]pyridin-5-ylmethanol is sourced from PubChem (CID 91666249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).