C12H17BNO6S- — CID 91666466
2-[(3R,6S)-2,2-dihydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1-oxa-2-boranuidacyclohex-6-yl]acetic acid (PubChem CID 91666466) has the molecular formula C12H17BNO6S- and a molecular weight of 314.15 g/mol. Its IUPAC name is 2-[(3R,6S)-2,2-dihydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1-oxa-2-boranuidacyclohex-6-yl]acetic acid.
| Compound Name | 2-[(3R,6S)-2,2-dihydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1-oxa-2-boranuidacyclohex-6-yl]acetic acid |
|---|---|
| PubChem CID | 91666466 |
| Molecular Formula | C12H17BNO6S- |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[(3R,6S)-2,2-dihydroxy-3-[(2-thiophen-2-ylacetyl)amino]-1-oxa-2-boranuidacyclohex-6-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CC[C@H](NC(=O)Cc2cccs2)[B-](O)(O)O1 |
| InChI | InChI=1S/C12H17BNO6S/c15-11(7-9-2-1-5-21-9)14-10-4-3-8(6-12(16)17)20-13(10,18)19/h1-2,5,8,10,18-19H,3-4,6-7H2,(H,14,15)(H,16,17)/q-1/t8-,10-/m0/s1 |
| InChIKey | ZHOJKQMRDCUTLH-WPRPVWTQSA-N |
| XLogP | -0.11 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|