About 2-(chloromethyl)oxirane;pentachloro-λ5-stibane
2-(chloromethyl)oxirane;pentachloro-λ5-stibane (PubChem CID 91666506) has the molecular formula C3H5Cl6OSb
and a molecular weight of 391.55 g/mol. Its IUPAC name is 2-(chloromethyl)oxirane;pentachloro-λ5-stibane.
Molecular Properties
| Compound Name | 2-(chloromethyl)oxirane;pentachloro-λ5-stibane |
| PubChem CID | 91666506 |
| Molecular Formula | C3H5Cl6OSb |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 387.75 |
| IUPAC Name | 2-(chloromethyl)oxirane;pentachloro-λ5-stibane |
| SMILES | ClCC1CO1.Cl[Sb](Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H5ClO.5ClH.Sb/c4-1-3-2-5-3;;;;;;/h3H,1-2H2;5*1H;/q;;;;;;+5/p-5 |
| InChIKey | ZLDUCODHECUOPH-UHFFFAOYSA-I |
| XLogP | 3.69 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)oxirane;pentachloro-λ5-stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)oxirane;pentachloro-λ5-stibane?
The IUPAC name of 2-(chloromethyl)oxirane;pentachloro-λ5-stibane (CID 91666506) is 2-(chloromethyl)oxirane;pentachloro-λ5-stibane.
What is the SMILES notation for 2-(chloromethyl)oxirane;pentachloro-λ5-stibane?
The canonical SMILES for 2-(chloromethyl)oxirane;pentachloro-λ5-stibane is ClCC1CO1.Cl[Sb](Cl)(Cl)(Cl)Cl.
What is the InChIKey of 2-(chloromethyl)oxirane;pentachloro-λ5-stibane?
The InChIKey is ZLDUCODHECUOPH-UHFFFAOYSA-I. The full InChI is InChI=1S/C3H5ClO.5ClH.Sb/c4-1-3-2-5-3;;;;;;/h3H,1-2H2;5*1H;/q;;;;;;+5/p-5.
What are the key properties of 2-(chloromethyl)oxirane;pentachloro-λ5-stibane?
2-(chloromethyl)oxirane;pentachloro-λ5-stibane has a molecular weight of 391.55 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)oxirane;pentachloro-λ5-stibane is sourced from PubChem (CID 91666506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).