C16H19N7O2S — CID 91666630
2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-1-prop-2-enoylpyrrolidin-3-yl]amino]pyrimidine-5-carboxamide (PubChem CID 91666630) has the molecular formula C16H19N7O2S and a molecular weight of 373.44 g/mol. Its IUPAC name is 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-1-prop-2-enoylpyrrolidin-3-yl]amino]pyrimidine-5-carboxamide.
| Compound Name | 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-1-prop-2-enoylpyrrolidin-3-yl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91666630 |
| Molecular Formula | C16H19N7O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3R)-1-prop-2-enoylpyrrolidin-3-yl]amino]pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)N1CC[C@@H](Nc2nc(Nc3cc(C)ns3)ncc2C(N)=O)C1 |
| InChI | InChI=1S/C16H19N7O2S/c1-3-13(24)23-5-4-10(8-23)19-15-11(14(17)25)7-18-16(21-15)20-12-6-9(2)22-26-12/h3,6-7,10H,1,4-5,8H2,2H3,(H2,17,25)(H2,18,19,20,21)/t10-/m1/s1 |
| InChIKey | FPQXRORPFPKPIQ-SNVBAGLBSA-N |
| XLogP | 1.28 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|