C9H11NO — CID 91666706
8-methyl-2,4-dihydro-1H-3,1-benzoxazine (PubChem CID 91666706) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 8-methyl-2,4-dihydro-1H-3,1-benzoxazine.
| Compound Name | 8-methyl-2,4-dihydro-1H-3,1-benzoxazine |
|---|---|
| PubChem CID | 91666706 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 8-methyl-2,4-dihydro-1H-3,1-benzoxazine |
| SMILES | Cc1cccc2c1NCOC2 |
| InChI | InChI=1S/C9H11NO/c1-7-3-2-4-8-5-11-6-10-9(7)8/h2-4,10H,5-6H2,1H3 |
| InChIKey | CWRCRGSLJDDRQE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |