About 2-(2,6-dimethylphenyl)pyrazine
2-(2,6-dimethylphenyl)pyrazine (PubChem CID 91666747) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)pyrazine.
Molecular Properties
| Compound Name | 2-(2,6-dimethylphenyl)pyrazine |
| PubChem CID | 91666747 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-(2,6-dimethylphenyl)pyrazine |
| SMILES | Cc1cccc(C)c1-c1cnccn1 |
| InChI | InChI=1S/C12H12N2/c1-9-4-3-5-10(2)12(9)11-8-13-6-7-14-11/h3-8H,1-2H3 |
| InChIKey | YCBNSOKEODEGQS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,6-dimethylphenyl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylphenyl)pyrazine?
The IUPAC name of 2-(2,6-dimethylphenyl)pyrazine (CID 91666747) is 2-(2,6-dimethylphenyl)pyrazine.
What is the SMILES notation for 2-(2,6-dimethylphenyl)pyrazine?
The canonical SMILES for 2-(2,6-dimethylphenyl)pyrazine is Cc1cccc(C)c1-c1cnccn1.
What is the InChIKey of 2-(2,6-dimethylphenyl)pyrazine?
The InChIKey is YCBNSOKEODEGQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2/c1-9-4-3-5-10(2)12(9)11-8-13-6-7-14-11/h3-8H,1-2H3.
What are the key properties of 2-(2,6-dimethylphenyl)pyrazine?
2-(2,6-dimethylphenyl)pyrazine has a molecular weight of 184.24 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylphenyl)pyrazine is sourced from PubChem (CID 91666747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).