C10H20N2O — CID 91666792
4-(4,4-dimethylpyrrolidin-3-yl)morpholine (PubChem CID 91666792) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-(4,4-dimethylpyrrolidin-3-yl)morpholine.
| Compound Name | 4-(4,4-dimethylpyrrolidin-3-yl)morpholine |
|---|---|
| PubChem CID | 91666792 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 4-(4,4-dimethylpyrrolidin-3-yl)morpholine |
| SMILES | CC1(C)CNCC1N1CCOCC1 |
| InChI | InChI=1S/C10H20N2O/c1-10(2)8-11-7-9(10)12-3-5-13-6-4-12/h9,11H,3-8H2,1-2H3 |
| InChIKey | DSQBGRFYKLBMSQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |