C22H28ClN3O2 — CID 91667484
N-[1-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]piperidin-4-yl]cyclohexanecarboxamide (PubChem CID 91667484) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is N-[1-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]piperidin-4-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]piperidin-4-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 91667484 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[1-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]piperidin-4-yl]cyclohexanecarboxamide |
| SMILES | O=C(NC1CCN(Cc2cc(Cl)c3cccnc3c2O)CC1)C1CCCCC1 |
| InChI | InChI=1S/C22H28ClN3O2/c23-19-13-16(21(27)20-18(19)7-4-10-24-20)14-26-11-8-17(9-12-26)25-22(28)15-5-2-1-3-6-15/h4,7,10,13,15,17,27H,1-3,5-6,8-9,11-12,14H2,(H,25,28) |
| InChIKey | LWRDMKDMHFLQJG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|