About ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate
ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate (PubChem CID 91667514) has the molecular formula C21H22ClNO3
and a molecular weight of 371.86 g/mol. Its IUPAC name is ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate |
| PubChem CID | 91667514 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(Cl)cc2c1C(OC)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C21H22ClNO3/c1-5-26-21(24)19-18(16-11-15(22)6-7-17(16)23-19)20(25-4)14-9-12(2)8-13(3)10-14/h6-11,20,23H,5H2,1-4H3 |
| InChIKey | ZALUMISHQCEWOT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate?
The IUPAC name of ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate (CID 91667514) is ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate.
What is the SMILES notation for ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate?
The canonical SMILES for ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate is CCOC(=O)c1[nH]c2ccc(Cl)cc2c1C(OC)c1cc(C)cc(C)c1.
What is the InChIKey of ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate?
The InChIKey is ZALUMISHQCEWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClNO3/c1-5-26-21(24)19-18(16-11-15(22)6-7-17(16)23-19)20(25-4)14-9-12(2)8-13(3)10-14/h6-11,20,23H,5H2,1-4H3.
What are the key properties of ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate?
ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate has a molecular weight of 371.86 g/mol, XLogP of 5.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-chloro-3-[(3,5-dimethylphenyl)-methoxymethyl]-1H-indole-2-carboxylate is sourced from PubChem (CID 91667514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).