C40H40F6N4O5 — CID 91667533
N-[2-[3-(2-aminoethoxy)propoxy]ethyl]-4-[[2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(4-methoxyphenyl)imidazol-1-yl]methyl]benzamide (PubChem CID 91667533) has the molecular formula C40H40F6N4O5 and a molecular weight of 770.77 g/mol. Its IUPAC name is N-[2-[3-(2-aminoethoxy)propoxy]ethyl]-4-[[2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(4-methoxyphenyl)imidazol-1-yl]methyl]benzamide.
| Compound Name | N-[2-[3-(2-aminoethoxy)propoxy]ethyl]-4-[[2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(4-methoxyphenyl)imidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 91667533 |
| Molecular Formula | C40H40F6N4O5 |
| Molecular Weight | 770.77 g/mol |
| Exact Mass | 770.29 |
| IUPAC Name | N-[2-[3-(2-aminoethoxy)propoxy]ethyl]-4-[[2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(4-methoxyphenyl)imidazol-1-yl]methyl]benzamide |
| SMILES | COc1ccc(-c2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n(Cc3ccc(C(=O)NCCOCCCOCCN)cc3)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H40F6N4O5/c1-52-33-12-8-27(9-13-33)35-36(28-10-14-34(53-2)15-11-28)50(37(49-35)30-22-31(39(41,42)43)24-32(23-30)40(44,45)46)25-26-4-6-29(7-5-26)38(51)48-17-21-55-19-3-18-54-20-16-47/h4-15,22-24H,3,16-21,25,47H2,1-2H3,(H,48,51) |
| InChIKey | ZCAVVPQMDLKPCS-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.77 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|