C13H24BNO3 — CID 91667918
1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-1-yl]ethanone (PubChem CID 91667918) has the molecular formula C13H24BNO3 and a molecular weight of 253.15 g/mol. Its IUPAC name is 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-1-yl]ethanone.
| Compound Name | 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 91667918 |
| Molecular Formula | C13H24BNO3 |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC(B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C13H24BNO3/c1-10(16)15-8-6-7-11(9-15)14-17-12(2,3)13(4,5)18-14/h11H,6-9H2,1-5H3 |
| InChIKey | HLZDOUYMRSFVFW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|