C30H29F3N4O4S — CID 91668230
trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(4-fluorophenyl)-1,3-oxazol-5-yl]-5,5-difluorocyclohexane-1-carboxamide (PubChem CID 91668230) has the molecular formula C30H29F3N4O4S and a molecular weight of 598.65 g/mol. Its IUPAC name is trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(4-fluorophenyl)-1,3-oxazol-5-yl]-5,5-difluorocyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(4-fluorophenyl)-1,3-oxazol-5-yl]-5,5-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91668230 |
| Molecular Formula | C30H29F3N4O4S |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(4-fluorophenyl)-1,3-oxazol-5-yl]-5,5-difluorocyclohexane-1-carboxamide |
| SMILES | N#CC1(NC(=O)[C@@H]2CC(F)(F)CC[C@H]2c2oc(-c3ccc(F)cc3)nc2-c2ccc(N3CCS(=O)(=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C30H29F3N4O4S/c31-21-5-1-20(2-6-21)28-35-25(19-3-7-22(8-4-19)37-13-15-42(39,40)16-14-37)26(41-28)23-9-10-30(32,33)17-24(23)27(38)36-29(18-34)11-12-29/h1-8,23-24H,9-17H2,(H,36,38)/t23-,24-/m1/s1 |
| InChIKey | VVHRSHAVDIRTBV-DNQXCXABSA-N |
| XLogP | 5.07 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |