C11H23ClN2O — CID 91668524
4-amino-N-tert-butylcyclohexane-1-carboxamide;hydrochloride (PubChem CID 91668524) has the molecular formula C11H23ClN2O and a molecular weight of 234.77 g/mol. Its IUPAC name is 4-amino-N-tert-butylcyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 4-amino-N-tert-butylcyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 91668524 |
| Molecular Formula | C11H23ClN2O |
| Molecular Weight | 234.77 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 4-amino-N-tert-butylcyclohexane-1-carboxamide;hydrochloride |
| SMILES | CC(C)(C)NC(=O)C1CCC(N)CC1.Cl |
| InChI | InChI=1S/C11H22N2O.ClH/c1-11(2,3)13-10(14)8-4-6-9(12)7-5-8;/h8-9H,4-7,12H2,1-3H3,(H,13,14);1H |
| InChIKey | PFAJIVSXHDWGSE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |