C24H27FN4O3S — CID 91668657
N-[(1S)-1-[4-[(3R)-1-[5-(3-fluoropropoxy)-2-pyridinyl]pyrrolidin-3-yl]oxyphenyl]ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 91668657) has the molecular formula C24H27FN4O3S and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[(1S)-1-[4-[(3R)-1-[5-(3-fluoropropoxy)-2-pyridinyl]pyrrolidin-3-yl]oxyphenyl]ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-1-[4-[(3R)-1-[5-(3-fluoropropoxy)-2-pyridinyl]pyrrolidin-3-yl]oxyphenyl]ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 91668657 |
| Molecular Formula | C24H27FN4O3S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-[(1S)-1-[4-[(3R)-1-[5-(3-fluoropropoxy)-2-pyridinyl]pyrrolidin-3-yl]oxyphenyl]ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1cncs1)c1ccc(O[C@@H]2CCN(c3ccc(OCCCF)cn3)C2)cc1 |
| InChI | InChI=1S/C24H27FN4O3S/c1-17(28-24(30)22-14-26-16-33-22)18-3-5-19(6-4-18)32-21-9-11-29(15-21)23-8-7-20(13-27-23)31-12-2-10-25/h3-8,13-14,16-17,21H,2,9-12,15H2,1H3,(H,28,30)/t17-,21+/m0/s1 |
| InChIKey | GDDFEGQZDBIJQT-LAUBAEHRSA-N |
| XLogP | 4.43 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|